C13H13NO3 — CID 90678325
7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole (PubChem CID 90678325) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole.
| Compound Name | 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole |
|---|---|
| PubChem CID | 90678325 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole |
| SMILES | COc1cc2c(cc1OC)-c1nocc1CC2 |
| InChI | InChI=1S/C13H13NO3/c1-15-11-5-8-3-4-9-7-17-14-13(9)10(8)6-12(11)16-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | WTKZGXMSOCPUSI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |