About 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole
7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole (PubChem CID 90678325) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole.
Molecular Properties
| Compound Name | 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole |
| PubChem CID | 90678325 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole |
| SMILES | COc1cc2c(cc1OC)-c1nocc1CC2 |
| InChI | InChI=1S/C13H13NO3/c1-15-11-5-8-3-4-9-7-17-14-13(9)10(8)6-12(11)16-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | WTKZGXMSOCPUSI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole?
The IUPAC name of 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole (CID 90678325) is 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole.
What is the SMILES notation for 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole?
The canonical SMILES for 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole is COc1cc2c(cc1OC)-c1nocc1CC2.
What is the InChIKey of 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole?
The InChIKey is WTKZGXMSOCPUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-15-11-5-8-3-4-9-7-17-14-13(9)10(8)6-12(11)16-2/h5-7H,3-4H2,1-2H3.
What are the key properties of 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole?
7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole has a molecular weight of 231.25 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-4,5-dihydrobenzo[g][2,1]benzoxazole is sourced from PubChem (CID 90678325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).