C16H33N3O4 — CID 90682631
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-[[2-oxo-2-(pentylamino)ethyl]amino]propyl]butanamide (PubChem CID 90682631) has the molecular formula C16H33N3O4 and a molecular weight of 331.46 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-[[2-oxo-2-(pentylamino)ethyl]amino]propyl]butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-[[2-oxo-2-(pentylamino)ethyl]amino]propyl]butanamide |
|---|---|
| PubChem CID | 90682631 |
| Molecular Formula | C16H33N3O4 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-[[2-oxo-2-(pentylamino)ethyl]amino]propyl]butanamide |
| SMILES | CCCCCNC(=O)CNCCCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C16H33N3O4/c1-4-5-6-9-18-13(21)11-17-8-7-10-19-15(23)14(22)16(2,3)12-20/h14,17,20,22H,4-12H2,1-3H3,(H,18,21)(H,19,23)/t14-/m0/s1 |
| InChIKey | ZZLLHPHOPJDBFF-AWEZNQCLSA-N |
| XLogP | -0.23 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|