C22H23N3 — CID 90685009
N'-(N-(2,5-dimethylphenyl)anilino)-4-methylbenzenecarboximidamide (PubChem CID 90685009) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is N'-(N-(2,5-dimethylphenyl)anilino)-4-methylbenzenecarboximidamide.
| Compound Name | N'-(N-(2,5-dimethylphenyl)anilino)-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 90685009 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N'-(N-(2,5-dimethylphenyl)anilino)-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(C(N)=NN(c2ccccc2)c2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C22H23N3/c1-16-10-13-19(14-11-16)22(23)24-25(20-7-5-4-6-8-20)21-15-17(2)9-12-18(21)3/h4-15H,1-3H3,(H2,23,24) |
| InChIKey | YVOACZRSLILIIH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|