C9H9N2OS+ — CID 90707701
3-hydroxy-4-phenyl-1,3-thiazol-3-ium-2-amine (PubChem CID 90707701) has the molecular formula C9H9N2OS+ and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-hydroxy-4-phenyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | 3-hydroxy-4-phenyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 90707701 |
| Molecular Formula | C9H9N2OS+ |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-hydroxy-4-phenyl-1,3-thiazol-3-ium-2-amine |
| SMILES | Nc1scc(-c2ccccc2)[n+]1O |
| InChI | InChI=1S/C9H8N2OS/c10-9-11(12)8(6-13-9)7-4-2-1-3-5-7/h1-6,10,12H/p+1 |
| InChIKey | LOGIOMTWUUWFFR-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 50.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|