C45H44Br2N2O5S — CID 90711133
(2,4,6-trimethylphenyl)methyl (2R,3S)-4-(2,6-dibromo-4-cyanophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate (PubChem CID 90711133) has the molecular formula C45H44Br2N2O5S and a molecular weight of 884.73 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl (2R,3S)-4-(2,6-dibromo-4-cyanophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate.
| Compound Name | (2,4,6-trimethylphenyl)methyl (2R,3S)-4-(2,6-dibromo-4-cyanophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate |
|---|---|
| PubChem CID | 90711133 |
| Molecular Formula | C45H44Br2N2O5S |
| Molecular Weight | 884.73 g/mol |
| Exact Mass | 882.13 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl (2R,3S)-4-(2,6-dibromo-4-cyanophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate |
| SMILES | Cc1cc(C)c(COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](COc2c(Br)cc(C#N)cc2Br)SC(c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C45H44Br2N2O5S/c1-29-22-30(2)36(31(3)23-29)27-53-42(50)40(49-43(51)54-44(4,5)6)39(28-52-41-37(46)24-32(26-48)25-38(41)47)55-45(33-16-10-7-11-17-33,34-18-12-8-13-19-34)35-20-14-9-15-21-35/h7-25,39-40H,27-28H2,1-6H3,(H,49,51)/t39-,40+/m1/s1 |
| InChIKey | VVXJIKGQZFLTGM-PVXQIPPMSA-N |
| XLogP | 11.12 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.73 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|