C38H43NO5S — CID 70148904
(2,4,6-trimethylphenyl)methyl (2R,3S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate (PubChem CID 70148904) has the molecular formula C38H43NO5S and a molecular weight of 625.83 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl)methyl (2R,3S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate.
| Compound Name | (2,4,6-trimethylphenyl)methyl (2R,3S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate |
|---|---|
| PubChem CID | 70148904 |
| Molecular Formula | C38H43NO5S |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | (2,4,6-trimethylphenyl)methyl (2R,3S)-4-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylbutanoate |
| SMILES | Cc1cc(C)c(COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](CO)SC(c2ccccc2)(c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C38H43NO5S/c1-26-22-27(2)32(28(3)23-26)25-43-35(41)34(39-36(42)44-37(4,5)6)33(24-40)45-38(29-16-10-7-11-17-29,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h7-23,33-34,40H,24-25H2,1-6H3,(H,39,42)/t33-,34+/m1/s1 |
| InChIKey | IURIOYYBLXMNJE-NOCHOARKSA-N |
| XLogP | 7.63 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|