C29H33NO7S2 — CID 20607143
(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-3-tritylsulfanylbutanoic acid (PubChem CID 20607143) has the molecular formula C29H33NO7S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-3-tritylsulfanylbutanoic acid.
| Compound Name | (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-3-tritylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 20607143 |
| Molecular Formula | C29H33NO7S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxy-3-tritylsulfanylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)[C@@H](COS(C)(=O)=O)SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H33NO7S2/c1-28(2,3)37-27(33)30-25(26(31)32)24(20-36-39(4,34)35)38-29(21-14-8-5-9-15-21,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h5-19,24-25H,20H2,1-4H3,(H,30,33)(H,31,32)/t24-,25+/m1/s1 |
| InChIKey | UBMRJYZWMHNGJE-RPBOFIJWSA-N |
| XLogP | 5.03 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|