C17H32N4O4 — CID 90715144
3-[3-(3-iminopropoxy)-2,2-bis(3-iminopropoxymethyl)propoxy]propan-1-imine (PubChem CID 90715144) has the molecular formula C17H32N4O4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-[3-(3-iminopropoxy)-2,2-bis(3-iminopropoxymethyl)propoxy]propan-1-imine.
| Compound Name | 3-[3-(3-iminopropoxy)-2,2-bis(3-iminopropoxymethyl)propoxy]propan-1-imine |
|---|---|
| PubChem CID | 90715144 |
| Molecular Formula | C17H32N4O4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 3-[3-(3-iminopropoxy)-2,2-bis(3-iminopropoxymethyl)propoxy]propan-1-imine |
| SMILES | [H]/N=C/CCOCC(COCC/C=N/[H])(COCC/C=N/[H])COCC/C=N/[H] |
| InChI | InChI=1S/C17H32N4O4/c18-5-1-9-22-13-17(14-23-10-2-6-19,15-24-11-3-7-20)16-25-12-4-8-21/h5-8,18-21H,1-4,9-16H2/b18-5+,19-6+,20-7+,21-8+ |
| InChIKey | PRJGQSHATFOOBA-RQJUJAGHSA-N |
| XLogP | 2.20 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|