C16H22N4O6 — CID 90715457
N-[6-[(2,5-dihydroxypyrrole-1-carbonyl)amino]hexyl]-2,5-dihydroxypyrrole-1-carboxamide (PubChem CID 90715457) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[6-[(2,5-dihydroxypyrrole-1-carbonyl)amino]hexyl]-2,5-dihydroxypyrrole-1-carboxamide.
| Compound Name | N-[6-[(2,5-dihydroxypyrrole-1-carbonyl)amino]hexyl]-2,5-dihydroxypyrrole-1-carboxamide |
|---|---|
| PubChem CID | 90715457 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[6-[(2,5-dihydroxypyrrole-1-carbonyl)amino]hexyl]-2,5-dihydroxypyrrole-1-carboxamide |
| SMILES | O=C(NCCCCCCNC(=O)n1c(O)ccc1O)n1c(O)ccc1O |
| InChI | InChI=1S/C16H22N4O6/c21-11-5-6-12(22)19(11)15(25)17-9-3-1-2-4-10-18-16(26)20-13(23)7-8-14(20)24/h5-8,21-24H,1-4,9-10H2,(H,17,25)(H,18,26) |
| InChIKey | IZKABSOKYOGPLQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 148.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|