C12H23N5S — CID 90719036
[4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]methanethiol (PubChem CID 90719036) has the molecular formula C12H23N5S and a molecular weight of 269.42 g/mol. Its IUPAC name is [4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]methanethiol.
| Compound Name | [4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]methanethiol |
|---|---|
| PubChem CID | 90719036 |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | [4,6-bis(tert-butylamino)-1,3,5-triazin-2-yl]methanethiol |
| SMILES | CC(C)(C)Nc1nc(CS)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C12H23N5S/c1-11(2,3)16-9-13-8(7-18)14-10(15-9)17-12(4,5)6/h18H,7H2,1-6H3,(H2,13,14,15,16,17) |
| InChIKey | XNEJAWDEUXOTES-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|