C28H48B9N2O6 — CID 90724179
CID 90724179 (PubChem CID 90724179) has the molecular formula C28H48B9N2O6 and a molecular weight of 606.01 g/mol.
| Compound Name | CID 90724179 |
|---|---|
| PubChem CID | 90724179 |
| Molecular Formula | C28H48B9N2O6 |
| Molecular Weight | 606.01 g/mol |
| Exact Mass | 607.43 |
| IUPAC Name | — |
| SMILES | CC(=O)N[C@@H]1[C@@H](CC=O)CC(C)=C[C@H]1OC(C)C.CC(=O)N[C@@H]1[C@@H](CCO)CC(C)=C[C@H]1OC(C)C.[B][B]B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C14H25NO3.C14H23NO3.B9/c2*1-9(2)18-13-8-10(3)7-12(5-6-16)14(13)15-11(4)17;1-6-9(7(2)3)8(4)5/h8-9,12-14,16H,5-7H2,1-4H3,(H,15,17);6,8-9,12-14H,5,7H2,1-4H3,(H,15,17);/t2*12-,13+,14+;/m00./s1 |
| InChIKey | HWGUGCKJGBAQKW-YWBBBQEHSA-N |
| XLogP | 0.05 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.01 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|