C19H16ClN3O3S3 — CID 90726121
2-[5-[2-(3-butyl-5-chloro-6-isocyano-1,3-benzothiazol-2-ylidene)ethenyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 90726121) has the molecular formula C19H16ClN3O3S3 and a molecular weight of 466.01 g/mol. Its IUPAC name is 2-[5-[2-(3-butyl-5-chloro-6-isocyano-1,3-benzothiazol-2-ylidene)ethenyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[5-[2-(3-butyl-5-chloro-6-isocyano-1,3-benzothiazol-2-ylidene)ethenyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 90726121 |
| Molecular Formula | C19H16ClN3O3S3 |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 2-[5-[2-(3-butyl-5-chloro-6-isocyano-1,3-benzothiazol-2-ylidene)ethenyl]-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | [C-]#[N+]c1cc2c(cc1Cl)N(CCCC)C(=C=Cc1sc(=S)n(CC(=O)O)c1O)S2 |
| InChI | InChI=1S/C19H16ClN3O3S3/c1-3-4-7-22-13-8-11(20)12(21-2)9-15(13)28-16(22)6-5-14-18(26)23(10-17(24)25)19(27)29-14/h5,8-9,26H,3-4,7,10H2,1H3,(H,24,25) |
| InChIKey | ZXYBDEYNIHJDHJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|