C17H13N3O4S3 — CID 90824967
2-[4-hydroxy-5-[2-[3-(2-hydroxyethyl)-5-isocyano-1,3-benzothiazol-2-ylidene]ethenyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid (PubChem CID 90824967) has the molecular formula C17H13N3O4S3 and a molecular weight of 419.51 g/mol. Its IUPAC name is 2-[4-hydroxy-5-[2-[3-(2-hydroxyethyl)-5-isocyano-1,3-benzothiazol-2-ylidene]ethenyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-5-[2-[3-(2-hydroxyethyl)-5-isocyano-1,3-benzothiazol-2-ylidene]ethenyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 90824967 |
| Molecular Formula | C17H13N3O4S3 |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 2-[4-hydroxy-5-[2-[3-(2-hydroxyethyl)-5-isocyano-1,3-benzothiazol-2-ylidene]ethenyl]-2-sulfanylidene-1,3-thiazol-3-yl]acetic acid |
| SMILES | [C-]#[N+]c1ccc2c(c1)N(CCO)C(=C=Cc1sc(=S)n(CC(=O)O)c1O)S2 |
| InChI | InChI=1S/C17H13N3O4S3/c1-18-10-2-3-12-11(8-10)19(6-7-21)14(26-12)5-4-13-16(24)20(9-15(22)23)17(25)27-13/h2-4,8,21,24H,6-7,9H2,(H,22,23) |
| InChIKey | LVVYUGFXOYTDLA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|