C26H30N2O3S2 — CID 91079678
2-[4-hydroxy-2-sulfanylidene-5-[(4E)-5-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-1,2,4-trienyl]-1,3-thiazol-3-yl]acetic acid (PubChem CID 91079678) has the molecular formula C26H30N2O3S2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-[4-hydroxy-2-sulfanylidene-5-[(4E)-5-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-1,2,4-trienyl]-1,3-thiazol-3-yl]acetic acid.
| Compound Name | 2-[4-hydroxy-2-sulfanylidene-5-[(4E)-5-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-1,2,4-trienyl]-1,3-thiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 91079678 |
| Molecular Formula | C26H30N2O3S2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2-[4-hydroxy-2-sulfanylidene-5-[(4E)-5-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-1,2,4-trienyl]-1,3-thiazol-3-yl]acetic acid |
| SMILES | CC1(C)CCN2CCC(C)(C)c3cc(/C=C/C=C=Cc4sc(=S)n(CC(=O)O)c4O)cc1c32 |
| InChI | InChI=1S/C26H30N2O3S2/c1-25(2)10-12-27-13-11-26(3,4)19-15-17(14-18(25)22(19)27)8-6-5-7-9-20-23(31)28(16-21(29)30)24(32)33-20/h5-6,8-9,14-15,31H,10-13,16H2,1-4H3,(H,29,30)/b8-6+ |
| InChIKey | BNMPDIPHKAQELL-SOFGYWHQSA-N |
| XLogP | 6.12 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|