C32H35N3O6 — CID 59595295
2-[5-carboxy-3-(carboxymethyl)-2-[(1E,3E)-4-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]benzimidazol-1-ium-1-yl]acetate (PubChem CID 59595295) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is 2-[5-carboxy-3-(carboxymethyl)-2-[(1E,3E)-4-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]benzimidazol-1-ium-1-yl]acetate.
| Compound Name | 2-[5-carboxy-3-(carboxymethyl)-2-[(1E,3E)-4-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]benzimidazol-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 59595295 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-[5-carboxy-3-(carboxymethyl)-2-[(1E,3E)-4-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)buta-1,3-dienyl]benzimidazol-1-ium-1-yl]acetate |
| SMILES | CC1(C)CCN2CCC(C)(C)c3cc(/C=C/C=C/c4n(CC(=O)O)c5cc(C(=O)O)ccc5[n+]4CC(=O)[O-])cc1c32 |
| InChI | InChI=1S/C32H35N3O6/c1-31(2)11-13-33-14-12-32(3,4)23-16-20(15-22(31)29(23)33)7-5-6-8-26-34(18-27(36)37)24-10-9-21(30(40)41)17-25(24)35(26)19-28(38)39/h5-10,15-17H,11-14,18-19H2,1-4H3,(H2-,36,37,38,39,40,41) |
| InChIKey | OUZIPRNTLRGRHF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 126.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|