C21H27N3OS — CID 90740631
3-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-1-phenyl-4,2,1-benzoxathiazine (PubChem CID 90740631) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-1-phenyl-4,2,1-benzoxathiazine.
| Compound Name | 3-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-1-phenyl-4,2,1-benzoxathiazine |
|---|---|
| PubChem CID | 90740631 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-1-phenyl-4,2,1-benzoxathiazine |
| SMILES | CC1CN(CCC2Oc3ccccc3N(c3ccccc3)S2)CC(C)N1 |
| InChI | InChI=1S/C21H27N3OS/c1-16-14-23(15-17(2)22-16)13-12-21-25-20-11-7-6-10-19(20)24(26-21)18-8-4-3-5-9-18/h3-11,16-17,21-22H,12-15H2,1-2H3 |
| InChIKey | DQAILKXAIZKBMD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|