C20H24F2N4S — CID 91550158
1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-4-fluoro-3-(2-fluorophenyl)-2,1,3-benzothiadiazole (PubChem CID 91550158) has the molecular formula C20H24F2N4S and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-4-fluoro-3-(2-fluorophenyl)-2,1,3-benzothiadiazole.
| Compound Name | 1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-4-fluoro-3-(2-fluorophenyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 91550158 |
| Molecular Formula | C20H24F2N4S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-4-fluoro-3-(2-fluorophenyl)-2,1,3-benzothiadiazole |
| SMILES | CC1CN(CCN2SN(c3ccccc3F)c3c(F)cccc32)CC(C)N1 |
| InChI | InChI=1S/C20H24F2N4S/c1-14-12-24(13-15(2)23-14)10-11-25-19-9-5-7-17(22)20(19)26(27-25)18-8-4-3-6-16(18)21/h3-9,14-15,23H,10-13H2,1-2H3 |
| InChIKey | ONGMBPSNOBOEFX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|