C16H17F2N3S — CID 143693881
3-[3-(2,6-difluorophenyl)-2,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine (PubChem CID 143693881) has the molecular formula C16H17F2N3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-[3-(2,6-difluorophenyl)-2,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[3-(2,6-difluorophenyl)-2,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143693881 |
| Molecular Formula | C16H17F2N3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[3-(2,6-difluorophenyl)-2,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1SN(c2c(F)cccc2F)c2ccccc21 |
| InChI | InChI=1S/C16H17F2N3S/c1-19-10-5-11-20-14-8-2-3-9-15(14)21(22-20)16-12(17)6-4-7-13(16)18/h2-4,6-9,19H,5,10-11H2,1H3 |
| InChIKey | FCZSHWBPRBGEJP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|