C16H14FNOS — CID 90762565
6-fluoro-1-phenyl-3-prop-2-enyl-4,2,1-benzoxathiazine (PubChem CID 90762565) has the molecular formula C16H14FNOS and a molecular weight of 287.36 g/mol. Its IUPAC name is 6-fluoro-1-phenyl-3-prop-2-enyl-4,2,1-benzoxathiazine.
| Compound Name | 6-fluoro-1-phenyl-3-prop-2-enyl-4,2,1-benzoxathiazine |
|---|---|
| PubChem CID | 90762565 |
| Molecular Formula | C16H14FNOS |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-fluoro-1-phenyl-3-prop-2-enyl-4,2,1-benzoxathiazine |
| SMILES | C=CCC1Oc2cc(F)ccc2N(c2ccccc2)S1 |
| InChI | InChI=1S/C16H14FNOS/c1-2-6-16-19-15-11-12(17)9-10-14(15)18(20-16)13-7-4-3-5-8-13/h2-5,7-11,16H,1,6H2 |
| InChIKey | VAYPRXXVTRGJOT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|