C27H32N2O8 — CID 90740970
(7R,7aR,8S,8aR,12aS)-9-(dimethylamino)-8,12a-dihydroxy-4,4,7-trimethyl-10,12,13,14-tetraoxo-2,3,7,7a,8,8a,9,13a-octahydroanthra[3,2-h]chromene-11-carboxamide (PubChem CID 90740970) has the molecular formula C27H32N2O8 and a molecular weight of 512.56 g/mol. Its IUPAC name is (7R,7aR,8S,8aR,12aS)-9-(dimethylamino)-8,12a-dihydroxy-4,4,7-trimethyl-10,12,13,14-tetraoxo-2,3,7,7a,8,8a,9,13a-octahydroanthra[3,2-h]chromene-11-carboxamide.
| Compound Name | (7R,7aR,8S,8aR,12aS)-9-(dimethylamino)-8,12a-dihydroxy-4,4,7-trimethyl-10,12,13,14-tetraoxo-2,3,7,7a,8,8a,9,13a-octahydroanthra[3,2-h]chromene-11-carboxamide |
|---|---|
| PubChem CID | 90740970 |
| Molecular Formula | C27H32N2O8 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (7R,7aR,8S,8aR,12aS)-9-(dimethylamino)-8,12a-dihydroxy-4,4,7-trimethyl-10,12,13,14-tetraoxo-2,3,7,7a,8,8a,9,13a-octahydroanthra[3,2-h]chromene-11-carboxamide |
| SMILES | C[C@H]1c2ccc3c(c2C(=O)C2C(=O)[C@]4(O)C(=O)C(C(N)=O)C(=O)C(N(C)C)[C@@H]4[C@@H](O)[C@@H]21)OCCC3(C)C |
| InChI | InChI=1S/C27H32N2O8/c1-10-11-6-7-12-22(37-9-8-26(12,2)3)14(11)19(30)15-13(10)20(31)17-18(29(4)5)21(32)16(25(28)35)24(34)27(17,36)23(15)33/h6-7,10,13,15-18,20,31,36H,8-9H2,1-5H3,(H2,28,35)/t10-,13+,15?,16?,17+,18?,20-,27-/m0/s1 |
| InChIKey | JZLXTBUJJVVGIJ-GNOQACHXSA-N |
| XLogP | -0.25 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|