C16H28O5 — CID 90742764
methyl (3R)-3-[2-[(4S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoate (PubChem CID 90742764) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl (3R)-3-[2-[(4S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoate.
| Compound Name | methyl (3R)-3-[2-[(4S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoate |
|---|---|
| PubChem CID | 90742764 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | methyl (3R)-3-[2-[(4S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]heptanoate |
| SMILES | CCCC[C@@H](C=C[C@@H]1OC(C)(C)OC1CO)CC(=O)OC |
| InChI | InChI=1S/C16H28O5/c1-5-6-7-12(10-15(18)19-4)8-9-13-14(11-17)21-16(2,3)20-13/h8-9,12-14,17H,5-7,10-11H2,1-4H3/t12-,13-,14?/m0/s1 |
| InChIKey | ISBAERKCNMLCSO-RFHHWMCGSA-N |
| XLogP | 2.42 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|