C14H22O5 — CID 90747842
2,3-dihydroxypropyl 2-(2-but-2-enyl-4-oxocyclopentyl)acetate (PubChem CID 90747842) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-(2-but-2-enyl-4-oxocyclopentyl)acetate.
| Compound Name | 2,3-dihydroxypropyl 2-(2-but-2-enyl-4-oxocyclopentyl)acetate |
|---|---|
| PubChem CID | 90747842 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2,3-dihydroxypropyl 2-(2-but-2-enyl-4-oxocyclopentyl)acetate |
| SMILES | CC=CCC1CC(=O)CC1CC(=O)OCC(O)CO |
| InChI | InChI=1S/C14H22O5/c1-2-3-4-10-5-12(16)6-11(10)7-14(18)19-9-13(17)8-15/h2-3,10-11,13,15,17H,4-9H2,1H3 |
| InChIKey | SJNZNKZOJJWXEI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|