C12H16O3 — CID 90769129
2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 90769129) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxan-2-yl)ethanone.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxan-2-yl)ethanone |
|---|---|
| PubChem CID | 90769129 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | O=C(CC1=CC=CCC1)C1COCCO1 |
| InChI | InChI=1S/C12H16O3/c13-11(12-9-14-6-7-15-12)8-10-4-2-1-3-5-10/h1-2,4,12H,3,5-9H2 |
| InChIKey | NTYWLJVAQZMOBK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |