C12H12N2O3S2 — CID 90772932
2-(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)ethylsulfanylformic acid (PubChem CID 90772932) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)ethylsulfanylformic acid.
| Compound Name | 2-(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)ethylsulfanylformic acid |
|---|---|
| PubChem CID | 90772932 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)ethylsulfanylformic acid |
| SMILES | O=C(O)SCCc1[nH]c(=S)n(-c2ccccc2)c1O |
| InChI | InChI=1S/C12H12N2O3S2/c15-10-9(6-7-19-12(16)17)13-11(18)14(10)8-4-2-1-3-5-8/h1-5,15H,6-7H2,(H,13,18)(H,16,17) |
| InChIKey | FRKVNKBVBKBOOU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|