C17H32F2O4PSi+ — CID 90774629
[4,4-difluoro-1-[(4R)-2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]octan-3-yl]oxy-dimethylsilanylium (PubChem CID 90774629) has the molecular formula C17H32F2O4PSi+ and a molecular weight of 397.50 g/mol. Its IUPAC name is [4,4-difluoro-1-[(4R)-2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]octan-3-yl]oxy-dimethylsilanylium.
| Compound Name | [4,4-difluoro-1-[(4R)-2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]octan-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 90774629 |
| Molecular Formula | C17H32F2O4PSi+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | [4,4-difluoro-1-[(4R)-2-oxo-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]octan-3-yl]oxy-dimethylsilanylium |
| SMILES | CCCCC(F)(F)C(CC[C@H]1C(OP)CC2OC(=O)CC21)O[SiH2+](C)C |
| InChI | InChI=1S/C17H32F2O4PSi/c1-4-5-8-17(18,19)15(23-25(2)3)7-6-11-12-9-16(20)21-13(12)10-14(11)22-24/h11-15H,4-10,24-25H2,1-3H3/q+1/t11-,12?,13?,14?,15?/m1/s1 |
| InChIKey | ZFJISOOKBGDAJB-SHIHICALSA-N |
| XLogP | 3.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|