C32H37N10O2+ — CID 90775119
cyclopentyl 4-[1-[3-[6-amino-3-(2H-triazol-4-ylmethyl)-7H-purin-3-ium-2-yl]phenyl]-2-phenylethyl]piperazine-1-carboxylate (PubChem CID 90775119) has the molecular formula C32H37N10O2+ and a molecular weight of 593.72 g/mol. Its IUPAC name is cyclopentyl 4-[1-[3-[6-amino-3-(2H-triazol-4-ylmethyl)-7H-purin-3-ium-2-yl]phenyl]-2-phenylethyl]piperazine-1-carboxylate.
| Compound Name | cyclopentyl 4-[1-[3-[6-amino-3-(2H-triazol-4-ylmethyl)-7H-purin-3-ium-2-yl]phenyl]-2-phenylethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90775119 |
| Molecular Formula | C32H37N10O2+ |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | cyclopentyl 4-[1-[3-[6-amino-3-(2H-triazol-4-ylmethyl)-7H-purin-3-ium-2-yl]phenyl]-2-phenylethyl]piperazine-1-carboxylate |
| SMILES | Nc1nc(-c2cccc(C(Cc3ccccc3)N3CCN(C(=O)OC4CCCC4)CC3)c2)[n+](Cc2cn[nH]n2)c2nc[nH]c12 |
| InChI | InChI=1S/C32H36N10O2/c33-29-28-31(35-21-34-28)42(20-25-19-36-39-38-25)30(37-29)24-10-6-9-23(18-24)27(17-22-7-2-1-3-8-22)40-13-15-41(16-14-40)32(43)44-26-11-4-5-12-26/h1-3,6-10,18-19,21,26-27H,4-5,11-17,20H2,(H3,33,34,35,36,38,39)/p+1 |
| InChIKey | SUZPELSQOFCNLV-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|