C24H35N3O2 — CID 90776260
(2S)-2-(decylamino)-3-[2-(pyridin-2-ylamino)phenyl]propanoic acid (PubChem CID 90776260) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is (2S)-2-(decylamino)-3-[2-(pyridin-2-ylamino)phenyl]propanoic acid.
| Compound Name | (2S)-2-(decylamino)-3-[2-(pyridin-2-ylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90776260 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | (2S)-2-(decylamino)-3-[2-(pyridin-2-ylamino)phenyl]propanoic acid |
| SMILES | CCCCCCCCCCN[C@@H](Cc1ccccc1Nc1ccccn1)C(=O)O |
| InChI | InChI=1S/C24H35N3O2/c1-2-3-4-5-6-7-8-12-17-25-22(24(28)29)19-20-14-9-10-15-21(20)27-23-16-11-13-18-26-23/h9-11,13-16,18,22,25H,2-8,12,17,19H2,1H3,(H,26,27)(H,28,29)/t22-/m0/s1 |
| InChIKey | OIAPGQSDHWJWFG-QFIPXVFZSA-N |
| XLogP | 5.55 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|