C17H17N3O4 — CID 90776638
6-hydroxy-5-[3-(4-morpholin-4-ylphenyl)propa-1,2-dienyl]-1H-pyrimidine-2,4-dione (PubChem CID 90776638) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 6-hydroxy-5-[3-(4-morpholin-4-ylphenyl)propa-1,2-dienyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[3-(4-morpholin-4-ylphenyl)propa-1,2-dienyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90776638 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 6-hydroxy-5-[3-(4-morpholin-4-ylphenyl)propa-1,2-dienyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(O)c(C=C=Cc2ccc(N3CCOCC3)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N3O4/c21-15-14(16(22)19-17(23)18-15)3-1-2-12-4-6-13(7-5-12)20-8-10-24-11-9-20/h2-7H,8-11H2,(H3,18,19,21,22,23) |
| InChIKey | HSWPXOLWOZYDOV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|