C68H80N4O4 — CID 90793937
5,10,15,20-tetrakis(4-hexoxyphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 90793937) has the molecular formula C68H80N4O4 and a molecular weight of 1017.41 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-hexoxyphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-hexoxyphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90793937 |
| Molecular Formula | C68H80N4O4 |
| Molecular Weight | 1017.41 g/mol |
| Exact Mass | 1016.62 |
| IUPAC Name | 5,10,15,20-tetrakis(4-hexoxyphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCCCCCOc1ccc(C2=c3ccc([nH]3)=C(c3ccc(OCCCCCC)cc3)c3ccc([nH]3)C(c3ccc(OCCCCCC)cc3)=c3ccc([nH]3)=C(c3ccc(OCCCCCC)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C68H80N4O4/c1-5-9-13-17-45-73-53-29-21-49(22-30-53)65-57-37-39-59(69-57)66(50-23-31-54(32-24-50)74-46-18-14-10-6-2)61-41-43-63(71-61)68(52-27-35-56(36-28-52)76-48-20-16-12-8-4)64-44-42-62(72-64)67(60-40-38-58(65)70-60)51-25-33-55(34-26-51)75-47-19-15-11-7-3/h21-44,69-72H,5-20,45-48H2,1-4H3 |
| InChIKey | PEXSFXLTPURRQY-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.41 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|