C23H28N4O6 — CID 90794764
tert-butyl (1R,3S,4S,6R)-3-[(2S)-2-cyanopyrrolidine-1-carbonyl]-6-(4-nitrophenoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 90794764) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is tert-butyl (1R,3S,4S,6R)-3-[(2S)-2-cyanopyrrolidine-1-carbonyl]-6-(4-nitrophenoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1R,3S,4S,6R)-3-[(2S)-2-cyanopyrrolidine-1-carbonyl]-6-(4-nitrophenoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 90794764 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | tert-butyl (1R,3S,4S,6R)-3-[(2S)-2-cyanopyrrolidine-1-carbonyl]-6-(4-nitrophenoxy)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H](C[C@H]2Oc2ccc([N+](=O)[O-])cc2)[C@H]1C(=O)N1CCC[C@H]1C#N |
| InChI | InChI=1S/C23H28N4O6/c1-23(2,3)33-22(29)26-18-11-14(20(26)21(28)25-10-4-5-16(25)13-24)12-19(18)32-17-8-6-15(7-9-17)27(30)31/h6-9,14,16,18-20H,4-5,10-12H2,1-3H3/t14-,16-,18+,19+,20-/m0/s1 |
| InChIKey | BTFWTIUKGCTRPL-UBVLKLFISA-N |
| XLogP | 3.25 |
| TPSA | 126.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|