C20H18O4 — CID 908018
4-[(2S,3R)-3-hydroxy-2,3-dihydro-1-benzofuran-2-yl]-5,7,8-trimethylchromen-2-one (PubChem CID 908018) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-[(2S,3R)-3-hydroxy-2,3-dihydro-1-benzofuran-2-yl]-5,7,8-trimethylchromen-2-one.
| Compound Name | 4-[(2S,3R)-3-hydroxy-2,3-dihydro-1-benzofuran-2-yl]-5,7,8-trimethylchromen-2-one |
|---|---|
| PubChem CID | 908018 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-[(2S,3R)-3-hydroxy-2,3-dihydro-1-benzofuran-2-yl]-5,7,8-trimethylchromen-2-one |
| SMILES | Cc1cc(C)c2c([C@@H]3Oc4ccccc4[C@H]3O)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H18O4/c1-10-8-11(2)17-14(9-16(21)24-19(17)12(10)3)20-18(22)13-6-4-5-7-15(13)23-20/h4-9,18,20,22H,1-3H3/t18-,20+/m1/s1 |
| InChIKey | LWUSYRIVKKUHAD-QUCCMNQESA-N |
| XLogP | 3.89 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|