C15H24N2O4 — CID 90809410
3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-(6-oxoheptyl)propanamide (PubChem CID 90809410) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-(6-oxoheptyl)propanamide.
| Compound Name | 3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-(6-oxoheptyl)propanamide |
|---|---|
| PubChem CID | 90809410 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-N-(6-oxoheptyl)propanamide |
| SMILES | CC(=O)CCCCCNC(=O)CCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C15H24N2O4/c1-11-10-14(20)17(15(11)21)9-7-13(19)16-8-5-3-4-6-12(2)18/h10,20-21H,3-9H2,1-2H3,(H,16,19) |
| InChIKey | CIGKRQZXVRQQPX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|