C16H29N4O4+ — CID 90858628
3-[[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-4-(methylamino)-4-oxobutanoyl]amino]propyl-trimethylazanium (PubChem CID 90858628) has the molecular formula C16H29N4O4+ and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-[[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-4-(methylamino)-4-oxobutanoyl]amino]propyl-trimethylazanium.
| Compound Name | 3-[[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-4-(methylamino)-4-oxobutanoyl]amino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 90858628 |
| Molecular Formula | C16H29N4O4+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 3-[[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)-4-(methylamino)-4-oxobutanoyl]amino]propyl-trimethylazanium |
| SMILES | CNC(=O)C(CC(=O)NCCC[N+](C)(C)C)n1c(O)cc(C)c1O |
| InChI | InChI=1S/C16H28N4O4/c1-11-9-14(22)19(16(11)24)12(15(23)17-2)10-13(21)18-7-6-8-20(3,4)5/h9,12H,6-8,10H2,1-5H3,(H3-,17,18,21,22,23,24)/p+1 |
| InChIKey | MORHTDGAPNBENN-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|