C26H46O6 — CID 90815424
(3R,4S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-6-[[(3S)-2-ethyl-4-methyl-3,4-dihydro-2H-pyran-3-yl]oxy]-4,5-dimethyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol (PubChem CID 90815424) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is (3R,4S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-6-[[(3S)-2-ethyl-4-methyl-3,4-dihydro-2H-pyran-3-yl]oxy]-4,5-dimethyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol.
| Compound Name | (3R,4S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-6-[[(3S)-2-ethyl-4-methyl-3,4-dihydro-2H-pyran-3-yl]oxy]-4,5-dimethyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 90815424 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (3R,4S,6R)-2-ethyl-6-[(3R,4R,6S)-2-ethyl-6-[[(3S)-2-ethyl-4-methyl-3,4-dihydro-2H-pyran-3-yl]oxy]-4,5-dimethyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol |
| SMILES | CCC1OC=CC(C)[C@@H]1O[C@@H]1OC(CC)[C@H](O[C@H]2OC(CC)[C@H](C)[C@H](O)C2C)[C@H](C)C1C |
| InChI | InChI=1S/C26H46O6/c1-9-19-17(7)22(27)18(8)26(29-19)32-24-15(5)16(6)25(30-21(24)11-3)31-23-14(4)12-13-28-20(23)10-2/h12-27H,9-11H2,1-8H3/t14?,15-,16?,17+,18?,19?,20?,21?,22+,23+,24-,25+,26-/m1/s1 |
| InChIKey | WRVXGANQXBWILR-VBEYCGLRSA-N |
| XLogP | 4.89 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |