C22H40O8 — CID 90246506
(2R,3S,4S,5R,6S)-2-ethyl-6-[(2S,3R,4S,5R)-4-hydroxy-2-[(2S,3R,4S,5R)-4-hydroxy-2,5-dimethyloxan-3-yl]oxy-5-methyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol (PubChem CID 90246506) has the molecular formula C22H40O8 and a molecular weight of 432.55 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-ethyl-6-[(2S,3R,4S,5R)-4-hydroxy-2-[(2S,3R,4S,5R)-4-hydroxy-2,5-dimethyloxan-3-yl]oxy-5-methyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol.
| Compound Name | (2R,3S,4S,5R,6S)-2-ethyl-6-[(2S,3R,4S,5R)-4-hydroxy-2-[(2S,3R,4S,5R)-4-hydroxy-2,5-dimethyloxan-3-yl]oxy-5-methyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 90246506 |
| Molecular Formula | C22H40O8 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-ethyl-6-[(2S,3R,4S,5R)-4-hydroxy-2-[(2S,3R,4S,5R)-4-hydroxy-2,5-dimethyloxan-3-yl]oxy-5-methyloxan-3-yl]oxy-3,5-dimethyloxan-4-ol |
| SMILES | CC[C@H]1O[C@@H](O[C@H]2[C@H](O[C@@H]3[C@@H](O)[C@H](C)CO[C@H]3C)OC[C@@H](C)[C@@H]2O)[C@H](C)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C22H40O8/c1-7-15-12(4)18(25)13(5)21(28-15)30-20-17(24)11(3)9-27-22(20)29-19-14(6)26-8-10(2)16(19)23/h10-25H,7-9H2,1-6H3/t10-,11-,12-,13-,14+,15-,16+,17+,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | NBIBYYMAXRFPMH-FTNSQVSPSA-N |
| XLogP | 1.29 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |