C48H50FN3O9 — CID 90835315
[4,5-dibenzoyloxy-6-[[4-[[4-[4-(butylamino)-4-oxobut-1-enyl]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-3-fluorooxan-2-yl]methyl benzoate (PubChem CID 90835315) has the molecular formula C48H50FN3O9 and a molecular weight of 831.94 g/mol. Its IUPAC name is [4,5-dibenzoyloxy-6-[[4-[[4-[4-(butylamino)-4-oxobut-1-enyl]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-3-fluorooxan-2-yl]methyl benzoate.
| Compound Name | [4,5-dibenzoyloxy-6-[[4-[[4-[4-(butylamino)-4-oxobut-1-enyl]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-3-fluorooxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90835315 |
| Molecular Formula | C48H50FN3O9 |
| Molecular Weight | 831.94 g/mol |
| Exact Mass | 831.35 |
| IUPAC Name | [4,5-dibenzoyloxy-6-[[4-[[4-[4-(butylamino)-4-oxobut-1-enyl]phenyl]methyl]-5-propan-2-yl-1H-pyrazol-3-yl]oxy]-3-fluorooxan-2-yl]methyl benzoate |
| SMILES | CCCCNC(=O)CC=Cc1ccc(Cc2c(OC3OC(COC(=O)c4ccccc4)C(F)C(OC(=O)c4ccccc4)C3OC(=O)c3ccccc3)n[nH]c2C(C)C)cc1 |
| InChI | InChI=1S/C48H50FN3O9/c1-4-5-28-50-39(53)23-15-16-32-24-26-33(27-25-32)29-37-41(31(2)3)51-52-44(37)61-48-43(60-47(56)36-21-13-8-14-22-36)42(59-46(55)35-19-11-7-12-20-35)40(49)38(58-48)30-57-45(54)34-17-9-6-10-18-34/h6-22,24-27,31,38,40,42-43,48H,4-5,23,28-30H2,1-3H3,(H,50,53)(H,51,52) |
| InChIKey | DLQBSAVTBMYRKW-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.94 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|