C22H41NO — CID 90836098
3-methoxy-N,3-dimethylnonadeca-8,11,14-trien-1-amine (PubChem CID 90836098) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is 3-methoxy-N,3-dimethylnonadeca-8,11,14-trien-1-amine.
| Compound Name | 3-methoxy-N,3-dimethylnonadeca-8,11,14-trien-1-amine |
|---|---|
| PubChem CID | 90836098 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | 3-methoxy-N,3-dimethylnonadeca-8,11,14-trien-1-amine |
| SMILES | CCCCC=CCC=CCC=CCCCCC(C)(CCNC)OC |
| InChI | InChI=1S/C22H41NO/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(2,24-4)20-21-23-3/h8-9,11-12,14-15,23H,5-7,10,13,16-21H2,1-4H3 |
| InChIKey | HFTSDHJBNDGJSQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|