C25H23F3N4O2 — CID 90842098
5-(4-pyridin-4-ylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90842098) has the molecular formula C25H23F3N4O2 and a molecular weight of 468.48 g/mol. Its IUPAC name is 5-(4-pyridin-4-ylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 5-(4-pyridin-4-ylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90842098 |
| Molecular Formula | C25H23F3N4O2 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 5-(4-pyridin-4-ylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2ccc(N3CCN(c4ccncc4)CC3)cc2cn1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3N4O2/c26-25(27,28)34-22-4-1-18(2-5-22)16-32-17-19-15-21(3-6-23(19)24(32)33)31-13-11-30(12-14-31)20-7-9-29-10-8-20/h1-10,15,17,33H,11-14,16H2 |
| InChIKey | CIJZWCVAKBFNKO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |