C13H14BrNO2 — CID 90846729
1-[(3-bromophenyl)methyl]-3,4-dimethylpyrrole-2,5-diol (PubChem CID 90846729) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-[(3-bromophenyl)methyl]-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90846729 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(Cc2cccc(Br)c2)c1O |
| InChI | InChI=1S/C13H14BrNO2/c1-8-9(2)13(17)15(12(8)16)7-10-4-3-5-11(14)6-10/h3-6,16-17H,7H2,1-2H3 |
| InChIKey | KLEJWDOZJBBGNT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |