C19H40 — CID 90852009
3,4,6,6,7,7-hexamethyl-5-propan-2-yldecane (PubChem CID 90852009) has the molecular formula C19H40 and a molecular weight of 268.53 g/mol. Its IUPAC name is 3,4,6,6,7,7-hexamethyl-5-propan-2-yldecane.
| Compound Name | 3,4,6,6,7,7-hexamethyl-5-propan-2-yldecane |
|---|---|
| PubChem CID | 90852009 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | 3,4,6,6,7,7-hexamethyl-5-propan-2-yldecane |
| SMILES | CCCC(C)(C)C(C)(C)C(C(C)C)C(C)C(C)CC |
| InChI | InChI=1S/C19H40/c1-11-13-18(7,8)19(9,10)17(14(3)4)16(6)15(5)12-2/h14-17H,11-13H2,1-10H3 |
| InChIKey | AEMDGDBNTLCROB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |