C10H14FNO4S — CID 90862340
2-[[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]amino]-4-hydroxybutanal (PubChem CID 90862340) has the molecular formula C10H14FNO4S and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]amino]-4-hydroxybutanal.
| Compound Name | 2-[[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]amino]-4-hydroxybutanal |
|---|---|
| PubChem CID | 90862340 |
| Molecular Formula | C10H14FNO4S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-[[(4-fluorophenyl)-dihydroxy-λ4-sulfanyl]amino]-4-hydroxybutanal |
| SMILES | O=CC(CCO)NS(O)(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H14FNO4S/c11-8-1-3-10(4-2-8)17(15,16)12-9(7-14)5-6-13/h1-4,7,9,12-13,15-16H,5-6H2 |
| InChIKey | DSTVNUAGHIVTBL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|