C22H18Cl2FN3O4S — CID 90873044
N-[2-[3-(carbamoylcarbamothioyl)-3,5-dichloro-4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl]phenyl]-3-fluorobenzamide (PubChem CID 90873044) has the molecular formula C22H18Cl2FN3O4S and a molecular weight of 510.37 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3,5-dichloro-4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3,5-dichloro-4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 90873044 |
| Molecular Formula | C22H18Cl2FN3O4S |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3,5-dichloro-4-hydroxy-4-methoxycyclohexa-1,5-dien-1-yl]phenyl]-3-fluorobenzamide |
| SMILES | COC1(O)C(Cl)=CC(c2ccccc2NC(=O)c2cccc(F)c2)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C22H18Cl2FN3O4S/c1-32-22(31)17(23)10-13(11-21(22,24)19(33)28-20(26)30)15-7-2-3-8-16(15)27-18(29)12-5-4-6-14(25)9-12/h2-11,31H,1H3,(H,27,29)(H3,26,28,30,33) |
| InChIKey | PUQSXZLCFUZJGU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|