C22H19ClFN3O3S2 — CID 91514403
N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide (PubChem CID 91514403) has the molecular formula C22H19ClFN3O3S2 and a molecular weight of 492.00 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 91514403 |
| Molecular Formula | C22H19ClFN3O3S2 |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide |
| SMILES | CSC1(O)C=CC(c2ccccc2NC(=O)c2ccccc2F)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C22H19ClFN3O3S2/c1-32-22(30)11-10-13(12-21(22,23)19(31)27-20(25)29)14-6-3-5-9-17(14)26-18(28)15-7-2-4-8-16(15)24/h2-12,30H,1H3,(H,26,28)(H3,25,27,29,31) |
| InChIKey | SFJJNJGHHVWYJX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|