C23H22ClFN4O3S — CID 91054737
N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-(dimethylamino)-4-hydroxycyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide (PubChem CID 91054737) has the molecular formula C23H22ClFN4O3S and a molecular weight of 488.97 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-(dimethylamino)-4-hydroxycyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-(dimethylamino)-4-hydroxycyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 91054737 |
| Molecular Formula | C23H22ClFN4O3S |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-(dimethylamino)-4-hydroxycyclohexa-1,5-dien-1-yl]phenyl]-2-fluorobenzamide |
| SMILES | CN(C)C1(O)C=CC(c2ccccc2NC(=O)c2ccccc2F)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C23H22ClFN4O3S/c1-29(2)23(32)12-11-14(13-22(23,24)20(33)28-21(26)31)15-7-4-6-10-18(15)27-19(30)16-8-3-5-9-17(16)25/h3-13,32H,1-2H3,(H,27,30)(H3,26,28,31,33) |
| InChIKey | OYTQWHIHRZJDBL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|