C23H21ClFN3O3S2 — CID 91229425
N-[3-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-2-methylphenyl]-2-fluorobenzamide (PubChem CID 91229425) has the molecular formula C23H21ClFN3O3S2 and a molecular weight of 506.02 g/mol. Its IUPAC name is N-[3-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-2-methylphenyl]-2-fluorobenzamide.
| Compound Name | N-[3-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-2-methylphenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 91229425 |
| Molecular Formula | C23H21ClFN3O3S2 |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | N-[3-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-2-methylphenyl]-2-fluorobenzamide |
| SMILES | CSC1(O)C=CC(c2cccc(NC(=O)c3ccccc3F)c2C)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C23H21ClFN3O3S2/c1-13-15(7-5-9-18(13)27-19(29)16-6-3-4-8-17(16)25)14-10-11-23(31,33-2)22(24,12-14)20(32)28-21(26)30/h3-12,31H,1-2H3,(H,27,29)(H3,26,28,30,32) |
| InChIKey | QTHOMGAKRATZSC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|