C20H19ClN4O6S2 — CID 91360678
N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(methanesulfonamido)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide (PubChem CID 91360678) has the molecular formula C20H19ClN4O6S2 and a molecular weight of 510.98 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(methanesulfonamido)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(methanesulfonamido)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91360678 |
| Molecular Formula | C20H19ClN4O6S2 |
| Molecular Weight | 510.98 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(methanesulfonamido)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide |
| SMILES | CS(=O)(=O)NC1(O)C=CC(c2ccccc2NC(=O)c2ccco2)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C20H19ClN4O6S2/c1-33(29,30)25-20(28)9-8-12(11-19(20,21)17(32)24-18(22)27)13-5-2-3-6-14(13)23-16(26)15-7-4-10-31-15/h2-11,25,28H,1H3,(H,23,26)(H3,22,24,27,32) |
| InChIKey | MXVUALPCCDQPDV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.98 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|