C20H15ClF3N3O4S2 — CID 91438325
N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide (PubChem CID 91438325) has the molecular formula C20H15ClF3N3O4S2 and a molecular weight of 517.94 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91438325 |
| Molecular Formula | C20H15ClF3N3O4S2 |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-(trifluoromethylsulfanyl)cyclohexa-1,5-dien-1-yl]phenyl]furan-2-carboxamide |
| SMILES | NC(=O)NC(=S)C1(Cl)C=C(c2ccccc2NC(=O)c2ccco2)C=CC1(O)SC(F)(F)F |
| InChI | InChI=1S/C20H15ClF3N3O4S2/c21-18(16(32)27-17(25)29)10-11(7-8-19(18,30)33-20(22,23)24)12-4-1-2-5-13(12)26-15(28)14-6-3-9-31-14/h1-10,30H,(H,26,28)(H3,25,27,29,32) |
| InChIKey | HUZCEEFARBBPHP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|