C22H18Cl2FN3O3S2 — CID 90999799
N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-3-chlorophenyl]-2-fluorobenzamide (PubChem CID 90999799) has the molecular formula C22H18Cl2FN3O3S2 and a molecular weight of 526.44 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-3-chlorophenyl]-2-fluorobenzamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-3-chlorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 90999799 |
| Molecular Formula | C22H18Cl2FN3O3S2 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfanylcyclohexa-1,5-dien-1-yl]-3-chlorophenyl]-2-fluorobenzamide |
| SMILES | CSC1(O)C=CC(c2c(Cl)cccc2NC(=O)c2ccccc2F)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C22H18Cl2FN3O3S2/c1-33-22(31)10-9-12(11-21(22,24)19(32)28-20(26)30)17-14(23)6-4-8-16(17)27-18(29)13-5-2-3-7-15(13)25/h2-11,31H,1H3,(H,27,29)(H3,26,28,30,32) |
| InChIKey | IZJSNWLQMNHARD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|