C22H18ClF2N3O4S2 — CID 91295093
N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfinylcyclohexa-1,5-dien-1-yl]phenyl]-2,6-difluorobenzamide (PubChem CID 91295093) has the molecular formula C22H18ClF2N3O4S2 and a molecular weight of 525.99 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfinylcyclohexa-1,5-dien-1-yl]phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfinylcyclohexa-1,5-dien-1-yl]phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 91295093 |
| Molecular Formula | C22H18ClF2N3O4S2 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-3-chloro-4-hydroxy-4-methylsulfinylcyclohexa-1,5-dien-1-yl]phenyl]-2,6-difluorobenzamide |
| SMILES | CS(=O)C1(O)C=CC(c2ccccc2NC(=O)c2c(F)cccc2F)=CC1(Cl)C(=S)NC(N)=O |
| InChI | InChI=1S/C22H18ClF2N3O4S2/c1-34(32)22(31)10-9-12(11-21(22,23)19(33)28-20(26)30)13-5-2-3-8-16(13)27-18(29)17-14(24)6-4-7-15(17)25/h2-11,31H,1H3,(H,27,29)(H3,26,28,30,33) |
| InChIKey | ZQNVAQYOUZRWNZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|