C17H15ClF3N3O3S — CID 90992072
N-[2-[3-(carbamoylcarbamothioyl)-4-chloro-4-hydroxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]phenyl]acetamide (PubChem CID 90992072) has the molecular formula C17H15ClF3N3O3S and a molecular weight of 433.84 g/mol. Its IUPAC name is N-[2-[3-(carbamoylcarbamothioyl)-4-chloro-4-hydroxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]phenyl]acetamide.
| Compound Name | N-[2-[3-(carbamoylcarbamothioyl)-4-chloro-4-hydroxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 90992072 |
| Molecular Formula | C17H15ClF3N3O3S |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | N-[2-[3-(carbamoylcarbamothioyl)-4-chloro-4-hydroxy-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1C1=CC(C(=S)NC(N)=O)(C(F)(F)F)C(O)(Cl)C=C1 |
| InChI | InChI=1S/C17H15ClF3N3O3S/c1-9(25)23-12-5-3-2-4-11(12)10-6-7-16(18,27)15(8-10,17(19,20)21)13(28)24-14(22)26/h2-8,27H,1H3,(H,23,25)(H3,22,24,26,28) |
| InChIKey | BZDFDZPSKUNOTH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|